C50H54N4 — CID 122433677
3,6-ditert-butyl-9-[4-[3-(3,6-ditert-butylcarbazol-9-yl)-4-pyridinyl]-3-pyridinyl]carbazole (PubChem CID 122433677) has the molecular formula C50H54N4 and a molecular weight of 711.01 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-[4-[3-(3,6-ditert-butylcarbazol-9-yl)-4-pyridinyl]-3-pyridinyl]carbazole.
| Compound Name | 3,6-ditert-butyl-9-[4-[3-(3,6-ditert-butylcarbazol-9-yl)-4-pyridinyl]-3-pyridinyl]carbazole |
|---|---|
| PubChem CID | 122433677 |
| Molecular Formula | C50H54N4 |
| Molecular Weight | 711.01 g/mol |
| Exact Mass | 710.43 |
| IUPAC Name | 3,6-ditert-butyl-9-[4-[3-(3,6-ditert-butylcarbazol-9-yl)-4-pyridinyl]-3-pyridinyl]carbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1cnccc1-c1ccncc1-n1c2ccc(C(C)(C)C)cc2c2cc(C(C)(C)C)ccc21 |
| InChI | InChI=1S/C50H54N4/c1-47(2,3)31-13-17-41-37(25-31)38-26-32(48(4,5)6)14-18-42(38)53(41)45-29-51-23-21-35(45)36-22-24-52-30-46(36)54-43-19-15-33(49(7,8)9)27-39(43)40-28-34(50(10,11)12)16-20-44(40)54/h13-30H,1-12H3 |
| InChIKey | WJNYGURBCIRVHG-UHFFFAOYSA-N |
| XLogP | 13.53 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.01 |
| LogP ≤ 5 | 13.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |