C52H54N4 — CID 140917926
1,4-bis(3,6-ditert-butylcarbazol-9-yl)phenazine (PubChem CID 140917926) has the molecular formula C52H54N4 and a molecular weight of 735.03 g/mol. Its IUPAC name is 1,4-bis(3,6-ditert-butylcarbazol-9-yl)phenazine.
| Compound Name | 1,4-bis(3,6-ditert-butylcarbazol-9-yl)phenazine |
|---|---|
| PubChem CID | 140917926 |
| Molecular Formula | C52H54N4 |
| Molecular Weight | 735.03 g/mol |
| Exact Mass | 734.43 |
| IUPAC Name | 1,4-bis(3,6-ditert-butylcarbazol-9-yl)phenazine |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1ccc(-n2c3ccc(C(C)(C)C)cc3c3cc(C(C)(C)C)ccc32)c2nc3ccccc3nc12 |
| InChI | InChI=1S/C52H54N4/c1-49(2,3)31-17-21-41-35(27-31)36-28-32(50(4,5)6)18-22-42(36)55(41)45-25-26-46(48-47(45)53-39-15-13-14-16-40(39)54-48)56-43-23-19-33(51(7,8)9)29-37(43)38-30-34(52(10,11)12)20-24-44(38)56/h13-30H,1-12H3 |
| InChIKey | WUFVQDGGJJZTKE-UHFFFAOYSA-N |
| XLogP | 14.17 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.03 |
| LogP ≤ 5 | 14.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|