C19H12S — CID 122434434
12H-fluoreno[2,1-b][1]benzothiole (PubChem CID 122434434) has the molecular formula C19H12S and a molecular weight of 272.37 g/mol. Its IUPAC name is 12H-fluoreno[2,1-b][1]benzothiole.
| Compound Name | 12H-fluoreno[2,1-b][1]benzothiole |
|---|---|
| PubChem CID | 122434434 |
| Molecular Formula | C19H12S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 12H-fluoreno[2,1-b][1]benzothiole |
| SMILES | c1ccc2c(c1)Cc1c-2ccc2sc3ccccc3c12 |
| InChI | InChI=1S/C19H12S/c1-2-6-13-12(5-1)11-16-14(13)9-10-18-19(16)15-7-3-4-8-17(15)20-18/h1-10H,11H2 |
| InChIKey | QJZNVTOZUAXDCL-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |