C16H14S — CID 141137697
2-methyl-2,3-dihydro-1H-indeno[5,4-b][1]benzothiole (PubChem CID 141137697) has the molecular formula C16H14S and a molecular weight of 238.36 g/mol. Its IUPAC name is 2-methyl-2,3-dihydro-1H-indeno[5,4-b][1]benzothiole.
| Compound Name | 2-methyl-2,3-dihydro-1H-indeno[5,4-b][1]benzothiole |
|---|---|
| PubChem CID | 141137697 |
| Molecular Formula | C16H14S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-methyl-2,3-dihydro-1H-indeno[5,4-b][1]benzothiole |
| SMILES | CC1Cc2ccc3sc4ccccc4c3c2C1 |
| InChI | InChI=1S/C16H14S/c1-10-8-11-6-7-15-16(13(11)9-10)12-4-2-3-5-14(12)17-15/h2-7,10H,8-9H2,1H3 |
| InChIKey | WXTIDGXOTJSWOR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |