C22H37NS — CID 157496126
N,N-dimethyldibenzothiophen-1-amine;ethane (PubChem CID 157496126) has the molecular formula C22H37NS and a molecular weight of 347.61 g/mol. Its IUPAC name is N,N-dimethyldibenzothiophen-1-amine;ethane.
| Compound Name | N,N-dimethyldibenzothiophen-1-amine;ethane |
|---|---|
| PubChem CID | 157496126 |
| Molecular Formula | C22H37NS |
| Molecular Weight | 347.61 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | N,N-dimethyldibenzothiophen-1-amine;ethane |
| SMILES | CC.CC.CC.CC.CN(C)c1cccc2sc3ccccc3c12 |
| InChI | InChI=1S/C14H13NS.4C2H6/c1-15(2)11-7-5-9-13-14(11)10-6-3-4-8-12(10)16-13;4*1-2/h3-9H,1-2H3;4*1-2H3 |
| InChIKey | BXVWKPPIVAULMS-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.61 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |