C17H19N3S — CID 71037971
2-dibenzothiophen-1-yl-1,1,3,3-tetramethylguanidine (PubChem CID 71037971) has the molecular formula C17H19N3S and a molecular weight of 297.43 g/mol. Its IUPAC name is 2-dibenzothiophen-1-yl-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-dibenzothiophen-1-yl-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 71037971 |
| Molecular Formula | C17H19N3S |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-dibenzothiophen-1-yl-1,1,3,3-tetramethylguanidine |
| SMILES | CN(C)C(=Nc1cccc2sc3ccccc3c12)N(C)C |
| InChI | InChI=1S/C17H19N3S/c1-19(2)17(20(3)4)18-13-9-7-11-15-16(13)12-8-5-6-10-14(12)21-15/h5-11H,1-4H3 |
| InChIKey | QXQKAZGSVTYQEG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|