C14H9NS — CID 57280205
1H-[1]benzothiolo[3,2-e]isoindole (PubChem CID 57280205) has the molecular formula C14H9NS and a molecular weight of 223.30 g/mol. Its IUPAC name is 1H-[1]benzothiolo[3,2-e]isoindole.
| Compound Name | 1H-[1]benzothiolo[3,2-e]isoindole |
|---|---|
| PubChem CID | 57280205 |
| Molecular Formula | C14H9NS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 1H-[1]benzothiolo[3,2-e]isoindole |
| SMILES | C1=NCc2c1ccc1sc3ccccc3c21 |
| InChI | InChI=1S/C14H9NS/c1-2-4-12-10(3-1)14-11-8-15-7-9(11)5-6-13(14)16-12/h1-7H,8H2 |
| InChIKey | WVVAGKILCDHZOZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |