C32H37N3O7 — CID 122437274
N-[2-(cyclohexylamino)-1-(4-nitrophenyl)-2-oxoethyl]-N-(3,4-dimethoxyphenyl)-3-(4-methoxyphenyl)propanamide (PubChem CID 122437274) has the molecular formula C32H37N3O7 and a molecular weight of 575.66 g/mol. Its IUPAC name is N-[2-(cyclohexylamino)-1-(4-nitrophenyl)-2-oxoethyl]-N-(3,4-dimethoxyphenyl)-3-(4-methoxyphenyl)propanamide.
| Compound Name | N-[2-(cyclohexylamino)-1-(4-nitrophenyl)-2-oxoethyl]-N-(3,4-dimethoxyphenyl)-3-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 122437274 |
| Molecular Formula | C32H37N3O7 |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | N-[2-(cyclohexylamino)-1-(4-nitrophenyl)-2-oxoethyl]-N-(3,4-dimethoxyphenyl)-3-(4-methoxyphenyl)propanamide |
| SMILES | COc1ccc(CCC(=O)N(c2ccc(OC)c(OC)c2)C(C(=O)NC2CCCCC2)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C32H37N3O7/c1-40-27-17-9-22(10-18-27)11-20-30(36)34(26-16-19-28(41-2)29(21-26)42-3)31(23-12-14-25(15-13-23)35(38)39)32(37)33-24-7-5-4-6-8-24/h9-10,12-19,21,24,31H,4-8,11,20H2,1-3H3,(H,33,37) |
| InChIKey | QWJZVGUHAHVTQM-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|