C31H38N2O6 — CID 122437429
N-(3,4-dimethoxyphenyl)-N-[1-(4-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]-3-(4-methoxyphenyl)propanamide (PubChem CID 122437429) has the molecular formula C31H38N2O6 and a molecular weight of 534.65 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-N-[1-(4-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]-3-(4-methoxyphenyl)propanamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-N-[1-(4-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]-3-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 122437429 |
| Molecular Formula | C31H38N2O6 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-N-[1-(4-hydroxyphenyl)-2-oxo-2-(pentylamino)ethyl]-3-(4-methoxyphenyl)propanamide |
| SMILES | CCCCCNC(=O)C(c1ccc(O)cc1)N(C(=O)CCc1ccc(OC)cc1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C31H38N2O6/c1-5-6-7-20-32-31(36)30(23-11-14-25(34)15-12-23)33(24-13-18-27(38-3)28(21-24)39-4)29(35)19-10-22-8-16-26(37-2)17-9-22/h8-9,11-18,21,30,34H,5-7,10,19-20H2,1-4H3,(H,32,36) |
| InChIKey | ZGBHUUJYSSYERX-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|