C26H34ClNO5 — CID 147652276
2-chloro-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[1-(4-hydroxyphenyl)-2-oxooctyl]acetamide (PubChem CID 147652276) has the molecular formula C26H34ClNO5 and a molecular weight of 476.01 g/mol. Its IUPAC name is 2-chloro-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[1-(4-hydroxyphenyl)-2-oxooctyl]acetamide.
| Compound Name | 2-chloro-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[1-(4-hydroxyphenyl)-2-oxooctyl]acetamide |
|---|---|
| PubChem CID | 147652276 |
| Molecular Formula | C26H34ClNO5 |
| Molecular Weight | 476.01 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 2-chloro-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[1-(4-hydroxyphenyl)-2-oxooctyl]acetamide |
| SMILES | CCCCCCC(=O)C(c1ccc(O)cc1)N(CCc1ccc(OC)c(OC)c1)C(=O)CCl |
| InChI | InChI=1S/C26H34ClNO5/c1-4-5-6-7-8-22(30)26(20-10-12-21(29)13-11-20)28(25(31)18-27)16-15-19-9-14-23(32-2)24(17-19)33-3/h9-14,17,26,29H,4-8,15-16,18H2,1-3H3 |
| InChIKey | GJSSWMSMBXNJIA-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.01 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|