C27H33ClN2O6 — CID 147306506
2-chloro-N-[3-cyclohexyl-1-(4-nitrophenyl)-2-oxopropyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide (PubChem CID 147306506) has the molecular formula C27H33ClN2O6 and a molecular weight of 517.02 g/mol. Its IUPAC name is 2-chloro-N-[3-cyclohexyl-1-(4-nitrophenyl)-2-oxopropyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-chloro-N-[3-cyclohexyl-1-(4-nitrophenyl)-2-oxopropyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 147306506 |
| Molecular Formula | C27H33ClN2O6 |
| Molecular Weight | 517.02 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | 2-chloro-N-[3-cyclohexyl-1-(4-nitrophenyl)-2-oxopropyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(CCN(C(=O)CCl)C(C(=O)CC2CCCCC2)c2ccc([N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C27H33ClN2O6/c1-35-24-13-8-20(17-25(24)36-2)14-15-29(26(32)18-28)27(21-9-11-22(12-10-21)30(33)34)23(31)16-19-6-4-3-5-7-19/h8-13,17,19,27H,3-7,14-16,18H2,1-2H3 |
| InChIKey | CXCQEOLXZFQZRW-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.02 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|