C30H31ClN2O7 — CID 153155194
4-chloro-N-[3-cyclohexyl-1-(4-hydroxyphenyl)-2-oxopropyl]-N-(3,4-dimethoxyphenyl)-2-nitrobenzamide (PubChem CID 153155194) has the molecular formula C30H31ClN2O7 and a molecular weight of 567.04 g/mol. Its IUPAC name is 4-chloro-N-[3-cyclohexyl-1-(4-hydroxyphenyl)-2-oxopropyl]-N-(3,4-dimethoxyphenyl)-2-nitrobenzamide.
| Compound Name | 4-chloro-N-[3-cyclohexyl-1-(4-hydroxyphenyl)-2-oxopropyl]-N-(3,4-dimethoxyphenyl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 153155194 |
| Molecular Formula | C30H31ClN2O7 |
| Molecular Weight | 567.04 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | 4-chloro-N-[3-cyclohexyl-1-(4-hydroxyphenyl)-2-oxopropyl]-N-(3,4-dimethoxyphenyl)-2-nitrobenzamide |
| SMILES | COc1ccc(N(C(=O)c2ccc(Cl)cc2[N+](=O)[O-])C(C(=O)CC2CCCCC2)c2ccc(O)cc2)cc1OC |
| InChI | InChI=1S/C30H31ClN2O7/c1-39-27-15-11-22(18-28(27)40-2)32(30(36)24-14-10-21(31)17-25(24)33(37)38)29(20-8-12-23(34)13-9-20)26(35)16-19-6-4-3-5-7-19/h8-15,17-19,29,34H,3-7,16H2,1-2H3 |
| InChIKey | WBGHZGPVCUOXOQ-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.04 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|