C29H29ClN4O8 — CID 122437320
N-[2-amino-1-cyclohexyl-1-(4-nitrophenyl)-2-oxoethyl]-4-chloro-N-(3,4-dimethoxyphenyl)-2-nitrobenzamide (PubChem CID 122437320) has the molecular formula C29H29ClN4O8 and a molecular weight of 597.02 g/mol. Its IUPAC name is N-[2-amino-1-cyclohexyl-1-(4-nitrophenyl)-2-oxoethyl]-4-chloro-N-(3,4-dimethoxyphenyl)-2-nitrobenzamide.
| Compound Name | N-[2-amino-1-cyclohexyl-1-(4-nitrophenyl)-2-oxoethyl]-4-chloro-N-(3,4-dimethoxyphenyl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 122437320 |
| Molecular Formula | C29H29ClN4O8 |
| Molecular Weight | 597.02 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | N-[2-amino-1-cyclohexyl-1-(4-nitrophenyl)-2-oxoethyl]-4-chloro-N-(3,4-dimethoxyphenyl)-2-nitrobenzamide |
| SMILES | COc1ccc(N(C(=O)c2ccc(Cl)cc2[N+](=O)[O-])C(C(N)=O)(c2ccc([N+](=O)[O-])cc2)C2CCCCC2)cc1OC |
| InChI | InChI=1S/C29H29ClN4O8/c1-41-25-15-13-22(17-26(25)42-2)32(27(35)23-14-10-20(30)16-24(23)34(39)40)29(28(31)36,18-6-4-3-5-7-18)19-8-11-21(12-9-19)33(37)38/h8-18H,3-7H2,1-2H3,(H2,31,36) |
| InChIKey | AILGEDMTXYQUFK-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 168.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.02 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|