C31H35N3O6 — CID 122437293
N-[2-amino-1-cyclohexyl-1-(4-nitrophenyl)-2-oxoethyl]-N-(3,4-dimethoxyphenyl)-2,5-dimethylbenzamide (PubChem CID 122437293) has the molecular formula C31H35N3O6 and a molecular weight of 545.64 g/mol. Its IUPAC name is N-[2-amino-1-cyclohexyl-1-(4-nitrophenyl)-2-oxoethyl]-N-(3,4-dimethoxyphenyl)-2,5-dimethylbenzamide.
| Compound Name | N-[2-amino-1-cyclohexyl-1-(4-nitrophenyl)-2-oxoethyl]-N-(3,4-dimethoxyphenyl)-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 122437293 |
| Molecular Formula | C31H35N3O6 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | N-[2-amino-1-cyclohexyl-1-(4-nitrophenyl)-2-oxoethyl]-N-(3,4-dimethoxyphenyl)-2,5-dimethylbenzamide |
| SMILES | COc1ccc(N(C(=O)c2cc(C)ccc2C)C(C(N)=O)(c2ccc([N+](=O)[O-])cc2)C2CCCCC2)cc1OC |
| InChI | InChI=1S/C31H35N3O6/c1-20-10-11-21(2)26(18-20)29(35)33(25-16-17-27(39-3)28(19-25)40-4)31(30(32)36,22-8-6-5-7-9-22)23-12-14-24(15-13-23)34(37)38/h10-19,22H,5-9H2,1-4H3,(H2,32,36) |
| InChIKey | UQRNYYFVZTYOSP-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|