C29H32ClN3O5 — CID 122437309
N-[2-(tert-butylamino)-1-(4-chlorophenyl)-2-oxoethyl]-5-methoxy-2-nitro-N-(4-propan-2-ylphenyl)benzamide (PubChem CID 122437309) has the molecular formula C29H32ClN3O5 and a molecular weight of 538.04 g/mol. Its IUPAC name is N-[2-(tert-butylamino)-1-(4-chlorophenyl)-2-oxoethyl]-5-methoxy-2-nitro-N-(4-propan-2-ylphenyl)benzamide.
| Compound Name | N-[2-(tert-butylamino)-1-(4-chlorophenyl)-2-oxoethyl]-5-methoxy-2-nitro-N-(4-propan-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 122437309 |
| Molecular Formula | C29H32ClN3O5 |
| Molecular Weight | 538.04 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | N-[2-(tert-butylamino)-1-(4-chlorophenyl)-2-oxoethyl]-5-methoxy-2-nitro-N-(4-propan-2-ylphenyl)benzamide |
| SMILES | COc1ccc([N+](=O)[O-])c(C(=O)N(c2ccc(C(C)C)cc2)C(C(=O)NC(C)(C)C)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C29H32ClN3O5/c1-18(2)19-9-13-22(14-10-19)32(28(35)24-17-23(38-6)15-16-25(24)33(36)37)26(27(34)31-29(3,4)5)20-7-11-21(30)12-8-20/h7-18,26H,1-6H3,(H,31,34) |
| InChIKey | WXVGHPLEUUXLSP-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.04 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|