About (E)-N-[2-(tert-butylamino)-1-(4-chlorophenyl)-2-oxoethyl]-N,3-diphenylprop-2-enamide
(E)-N-[2-(tert-butylamino)-1-(4-chlorophenyl)-2-oxoethyl]-N,3-diphenylprop-2-enamide (PubChem CID 154707342) has the molecular formula C27H27ClN2O2
and a molecular weight of 446.98 g/mol. Its IUPAC name is (E)-N-[2-(tert-butylamino)-1-(4-chlorophenyl)-2-oxoethyl]-N,3-diphenylprop-2-enamide.
Molecular Properties
| Compound Name | (E)-N-[2-(tert-butylamino)-1-(4-chlorophenyl)-2-oxoethyl]-N,3-diphenylprop-2-enamide |
| PubChem CID | 154707342 |
| Molecular Formula | C27H27ClN2O2 |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (E)-N-[2-(tert-butylamino)-1-(4-chlorophenyl)-2-oxoethyl]-N,3-diphenylprop-2-enamide |
| SMILES | CC(C)(C)NC(=O)C(c1ccc(Cl)cc1)N(C(=O)/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H27ClN2O2/c1-27(2,3)29-26(32)25(21-15-17-22(28)18-16-21)30(23-12-8-5-9-13-23)24(31)19-14-20-10-6-4-7-11-20/h4-19,25H,1-3H3,(H,29,32)/b19-14+ |
| InChIKey | RXWIMKWAMSLETK-XMHGGMMESA-N |
| XLogP | 6.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[2-(tert-butylamino)-1-(4-chlorophenyl)-2-oxoethyl]-N,3-diphenylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[2-(tert-butylamino)-1-(4-chlorophenyl)-2-oxoethyl]-N,3-diphenylprop-2-enamide?
The IUPAC name of (E)-N-[2-(tert-butylamino)-1-(4-chlorophenyl)-2-oxoethyl]-N,3-diphenylprop-2-enamide (CID 154707342) is (E)-N-[2-(tert-butylamino)-1-(4-chlorophenyl)-2-oxoethyl]-N,3-diphenylprop-2-enamide.
What is the SMILES notation for (E)-N-[2-(tert-butylamino)-1-(4-chlorophenyl)-2-oxoethyl]-N,3-diphenylprop-2-enamide?
The canonical SMILES for (E)-N-[2-(tert-butylamino)-1-(4-chlorophenyl)-2-oxoethyl]-N,3-diphenylprop-2-enamide is CC(C)(C)NC(=O)C(c1ccc(Cl)cc1)N(C(=O)/C=C/c1ccccc1)c1ccccc1.
What is the InChIKey of (E)-N-[2-(tert-butylamino)-1-(4-chlorophenyl)-2-oxoethyl]-N,3-diphenylprop-2-enamide?
The InChIKey is RXWIMKWAMSLETK-XMHGGMMESA-N. The full InChI is InChI=1S/C27H27ClN2O2/c1-27(2,3)29-26(32)25(21-15-17-22(28)18-16-21)30(23-12-8-5-9-13-23)24(31)19-14-20-10-6-4-7-11-20/h4-19,25H,1-3H3,(H,29,32)/b19-14+.
What are the key properties of (E)-N-[2-(tert-butylamino)-1-(4-chlorophenyl)-2-oxoethyl]-N,3-diphenylprop-2-enamide?
(E)-N-[2-(tert-butylamino)-1-(4-chlorophenyl)-2-oxoethyl]-N,3-diphenylprop-2-enamide has a molecular weight of 446.98 g/mol, XLogP of 6.04, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[2-(tert-butylamino)-1-(4-chlorophenyl)-2-oxoethyl]-N,3-diphenylprop-2-enamide is sourced from PubChem (CID 154707342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).