C27H28N2O2 — CID 102343014
(E)-N-[2-(tert-butylamino)-2-oxo-1-phenylethyl]-N,3-diphenylprop-2-enamide (PubChem CID 102343014) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is (E)-N-[2-(tert-butylamino)-2-oxo-1-phenylethyl]-N,3-diphenylprop-2-enamide.
| Compound Name | (E)-N-[2-(tert-butylamino)-2-oxo-1-phenylethyl]-N,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 102343014 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | (E)-N-[2-(tert-butylamino)-2-oxo-1-phenylethyl]-N,3-diphenylprop-2-enamide |
| SMILES | CC(C)(C)NC(=O)C(c1ccccc1)N(C(=O)/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H28N2O2/c1-27(2,3)28-26(31)25(22-15-9-5-10-16-22)29(23-17-11-6-12-18-23)24(30)20-19-21-13-7-4-8-14-21/h4-20,25H,1-3H3,(H,28,31)/b20-19+ |
| InChIKey | RZNJXEGPVYFKBL-FMQUCBEESA-N |
| XLogP | 5.39 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|