C27H26BrClN2O2 — CID 102343009
(E)-N-(4-bromophenyl)-N-[2-(tert-butylamino)-2-oxo-1-phenylethyl]-3-(4-chlorophenyl)prop-2-enamide (PubChem CID 102343009) has the molecular formula C27H26BrClN2O2 and a molecular weight of 525.87 g/mol. Its IUPAC name is (E)-N-(4-bromophenyl)-N-[2-(tert-butylamino)-2-oxo-1-phenylethyl]-3-(4-chlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(4-bromophenyl)-N-[2-(tert-butylamino)-2-oxo-1-phenylethyl]-3-(4-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 102343009 |
| Molecular Formula | C27H26BrClN2O2 |
| Molecular Weight | 525.87 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | (E)-N-(4-bromophenyl)-N-[2-(tert-butylamino)-2-oxo-1-phenylethyl]-3-(4-chlorophenyl)prop-2-enamide |
| SMILES | CC(C)(C)NC(=O)C(c1ccccc1)N(C(=O)/C=C/c1ccc(Cl)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C27H26BrClN2O2/c1-27(2,3)30-26(33)25(20-7-5-4-6-8-20)31(23-16-12-21(28)13-17-23)24(32)18-11-19-9-14-22(29)15-10-19/h4-18,25H,1-3H3,(H,30,33)/b18-11+ |
| InChIKey | QGGPPVXKONOUHL-WOJGMQOQSA-N |
| XLogP | 6.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.87 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|