C24H30BrN3O2 — CID 167746054
N-[1-(5-bromo-3-pyridinyl)-2-(tert-butylamino)-2-oxoethyl]-N-(4-tert-butylphenyl)prop-2-enamide (PubChem CID 167746054) has the molecular formula C24H30BrN3O2 and a molecular weight of 472.43 g/mol. Its IUPAC name is N-[1-(5-bromo-3-pyridinyl)-2-(tert-butylamino)-2-oxoethyl]-N-(4-tert-butylphenyl)prop-2-enamide.
| Compound Name | N-[1-(5-bromo-3-pyridinyl)-2-(tert-butylamino)-2-oxoethyl]-N-(4-tert-butylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 167746054 |
| Molecular Formula | C24H30BrN3O2 |
| Molecular Weight | 472.43 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | N-[1-(5-bromo-3-pyridinyl)-2-(tert-butylamino)-2-oxoethyl]-N-(4-tert-butylphenyl)prop-2-enamide |
| SMILES | C=CC(=O)N(c1ccc(C(C)(C)C)cc1)C(C(=O)NC(C)(C)C)c1cncc(Br)c1 |
| InChI | InChI=1S/C24H30BrN3O2/c1-8-20(29)28(19-11-9-17(10-12-19)23(2,3)4)21(22(30)27-24(5,6)7)16-13-18(25)15-26-14-16/h8-15,21H,1H2,2-7H3,(H,27,30) |
| InChIKey | JQKJNBHAAPCSDL-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.43 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|