C27H33N3O4 — CID 167909717
cis-methyl (1R,3S)-3-[[2-(4-tert-butyl-N-prop-2-enoylanilino)-2-pyridin-3-ylacetyl]amino]cyclopentane-1-carboxylate (PubChem CID 167909717) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is cis-methyl (1R,3S)-3-[[2-(4-tert-butyl-N-prop-2-enoylanilino)-2-pyridin-3-ylacetyl]amino]cyclopentane-1-carboxylate.
| Compound Name | cis-methyl (1R,3S)-3-[[2-(4-tert-butyl-N-prop-2-enoylanilino)-2-pyridin-3-ylacetyl]amino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 167909717 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | cis-methyl (1R,3S)-3-[[2-(4-tert-butyl-N-prop-2-enoylanilino)-2-pyridin-3-ylacetyl]amino]cyclopentane-1-carboxylate |
| SMILES | C=CC(=O)N(c1ccc(C(C)(C)C)cc1)C(C(=O)N[C@H]1CC[C@@H](C(=O)OC)C1)c1cccnc1 |
| InChI | InChI=1S/C27H33N3O4/c1-6-23(31)30(22-13-10-20(11-14-22)27(2,3)4)24(19-8-7-15-28-17-19)25(32)29-21-12-9-18(16-21)26(33)34-5/h6-8,10-11,13-15,17-18,21,24H,1,9,12,16H2,2-5H3,(H,29,32)/t18-,21+,24?/m1/s1 |
| InChIKey | CYNZKUHBVPZLBM-BGNYOVEWSA-N |
| XLogP | 4.10 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|