C29H38N4O3 — CID 166510372
(2R)-N-[2-(tert-butylamino)-2-oxo-1-pyridin-3-ylethyl]-N-(4-tert-butylphenyl)-1-prop-2-enoylpyrrolidine-2-carboxamide (PubChem CID 166510372) has the molecular formula C29H38N4O3 and a molecular weight of 490.65 g/mol. Its IUPAC name is (2R)-N-[2-(tert-butylamino)-2-oxo-1-pyridin-3-ylethyl]-N-(4-tert-butylphenyl)-1-prop-2-enoylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[2-(tert-butylamino)-2-oxo-1-pyridin-3-ylethyl]-N-(4-tert-butylphenyl)-1-prop-2-enoylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 166510372 |
| Molecular Formula | C29H38N4O3 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | (2R)-N-[2-(tert-butylamino)-2-oxo-1-pyridin-3-ylethyl]-N-(4-tert-butylphenyl)-1-prop-2-enoylpyrrolidine-2-carboxamide |
| SMILES | C=CC(=O)N1CCC[C@@H]1C(=O)N(c1ccc(C(C)(C)C)cc1)C(C(=O)NC(C)(C)C)c1cccnc1 |
| InChI | InChI=1S/C29H38N4O3/c1-8-24(34)32-18-10-12-23(32)27(36)33(22-15-13-21(14-16-22)28(2,3)4)25(20-11-9-17-30-19-20)26(35)31-29(5,6)7/h8-9,11,13-17,19,23,25H,1,10,12,18H2,2-7H3,(H,31,35)/t23-,25?/m1/s1 |
| InChIKey | RXELYKJVUYDLFU-XQZUBTRRSA-N |
| XLogP | 4.55 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|