C26H31N5O2 — CID 156894702
(2R)-N-[2-(azetidin-1-yl)-2-oxo-1-pyridin-3-ylethyl]-N-(4-tert-butylphenyl)-1-cyanopyrrolidine-2-carboxamide (PubChem CID 156894702) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is (2R)-N-[2-(azetidin-1-yl)-2-oxo-1-pyridin-3-ylethyl]-N-(4-tert-butylphenyl)-1-cyanopyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[2-(azetidin-1-yl)-2-oxo-1-pyridin-3-ylethyl]-N-(4-tert-butylphenyl)-1-cyanopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 156894702 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | (2R)-N-[2-(azetidin-1-yl)-2-oxo-1-pyridin-3-ylethyl]-N-(4-tert-butylphenyl)-1-cyanopyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(N(C(=O)[C@H]2CCCN2C#N)C(C(=O)N2CCC2)c2cccnc2)cc1 |
| InChI | InChI=1S/C26H31N5O2/c1-26(2,3)20-9-11-21(12-10-20)31(24(32)22-8-5-14-30(22)18-27)23(19-7-4-13-28-17-19)25(33)29-15-6-16-29/h4,7,9-13,17,22-23H,5-6,8,14-16H2,1-3H3/t22-,23?/m1/s1 |
| InChIKey | AXWUXNJJLDAJBD-WTQRLHSKSA-N |
| XLogP | 3.63 |
| TPSA | 80.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|