C28H38N6O2 — CID 156894752
(2R)-N-(4-tert-butylphenyl)-1-cyano-N-[2-[3-(dimethylamino)propylamino]-2-oxo-1-pyridin-3-ylethyl]pyrrolidine-2-carboxamide (PubChem CID 156894752) has the molecular formula C28H38N6O2 and a molecular weight of 490.65 g/mol. Its IUPAC name is (2R)-N-(4-tert-butylphenyl)-1-cyano-N-[2-[3-(dimethylamino)propylamino]-2-oxo-1-pyridin-3-ylethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-(4-tert-butylphenyl)-1-cyano-N-[2-[3-(dimethylamino)propylamino]-2-oxo-1-pyridin-3-ylethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 156894752 |
| Molecular Formula | C28H38N6O2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | (2R)-N-(4-tert-butylphenyl)-1-cyano-N-[2-[3-(dimethylamino)propylamino]-2-oxo-1-pyridin-3-ylethyl]pyrrolidine-2-carboxamide |
| SMILES | CN(C)CCCNC(=O)C(c1cccnc1)N(C(=O)[C@H]1CCCN1C#N)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H38N6O2/c1-28(2,3)22-11-13-23(14-12-22)34(27(36)24-10-7-18-33(24)20-29)25(21-9-6-15-30-19-21)26(35)31-16-8-17-32(4)5/h6,9,11-15,19,24-25H,7-8,10,16-18H2,1-5H3,(H,31,35)/t24-,25?/m1/s1 |
| InChIKey | NLTNXXNYIWRSDS-IKOFQBKESA-N |
| XLogP | 3.47 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|