C27H39N5O2 — CID 166040279
(2R)-N-(4-tert-butylphenyl)-N-[2-[3-(dimethylamino)propylamino]-2-oxo-1-pyridin-3-ylethyl]pyrrolidine-2-carboxamide (PubChem CID 166040279) has the molecular formula C27H39N5O2 and a molecular weight of 465.64 g/mol. Its IUPAC name is (2R)-N-(4-tert-butylphenyl)-N-[2-[3-(dimethylamino)propylamino]-2-oxo-1-pyridin-3-ylethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-(4-tert-butylphenyl)-N-[2-[3-(dimethylamino)propylamino]-2-oxo-1-pyridin-3-ylethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 166040279 |
| Molecular Formula | C27H39N5O2 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.31 |
| IUPAC Name | (2R)-N-(4-tert-butylphenyl)-N-[2-[3-(dimethylamino)propylamino]-2-oxo-1-pyridin-3-ylethyl]pyrrolidine-2-carboxamide |
| SMILES | CN(C)CCCNC(=O)C(c1cccnc1)N(C(=O)[C@H]1CCCN1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H39N5O2/c1-27(2,3)21-11-13-22(14-12-21)32(26(34)23-10-7-16-29-23)24(20-9-6-15-28-19-20)25(33)30-17-8-18-31(4)5/h6,9,11-15,19,23-24,29H,7-8,10,16-18H2,1-5H3,(H,30,33)/t23-,24?/m1/s1 |
| InChIKey | CDYPZNFADUVIBR-MIHMCVIASA-N |
| XLogP | 3.27 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|