C26H36N4O3 — CID 156894262
N-(4-tert-butylphenyl)-N-[2-(3-methoxypropylamino)-2-oxo-1-pyridin-3-ylethyl]pyrrolidine-2-carboxamide (PubChem CID 156894262) has the molecular formula C26H36N4O3 and a molecular weight of 452.60 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-N-[2-(3-methoxypropylamino)-2-oxo-1-pyridin-3-ylethyl]pyrrolidine-2-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-N-[2-(3-methoxypropylamino)-2-oxo-1-pyridin-3-ylethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 156894262 |
| Molecular Formula | C26H36N4O3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | N-(4-tert-butylphenyl)-N-[2-(3-methoxypropylamino)-2-oxo-1-pyridin-3-ylethyl]pyrrolidine-2-carboxamide |
| SMILES | COCCCNC(=O)C(c1cccnc1)N(C(=O)C1CCCN1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H36N4O3/c1-26(2,3)20-10-12-21(13-11-20)30(25(32)22-9-6-15-28-22)23(19-8-5-14-27-18-19)24(31)29-16-7-17-33-4/h5,8,10-14,18,22-23,28H,6-7,9,15-17H2,1-4H3,(H,29,31) |
| InChIKey | OJUZAZQSWGAVBF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|