C26H42N4O3 — CID 156892771
2-[4-tert-butyl-N-(pyrrolidin-2-ylmethoxymethyl)anilino]-N-(2-methoxyethyl)-2-pyridin-3-ylacetamide;molecular hydrogen (PubChem CID 156892771) has the molecular formula C26H42N4O3 and a molecular weight of 458.65 g/mol. Its IUPAC name is 2-[4-tert-butyl-N-(pyrrolidin-2-ylmethoxymethyl)anilino]-N-(2-methoxyethyl)-2-pyridin-3-ylacetamide;molecular hydrogen.
| Compound Name | 2-[4-tert-butyl-N-(pyrrolidin-2-ylmethoxymethyl)anilino]-N-(2-methoxyethyl)-2-pyridin-3-ylacetamide;molecular hydrogen |
|---|---|
| PubChem CID | 156892771 |
| Molecular Formula | C26H42N4O3 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.33 |
| IUPAC Name | 2-[4-tert-butyl-N-(pyrrolidin-2-ylmethoxymethyl)anilino]-N-(2-methoxyethyl)-2-pyridin-3-ylacetamide;molecular hydrogen |
| SMILES | COCCNC(=O)C(c1cccnc1)N(COCC1CCCN1)c1ccc(C(C)(C)C)cc1.[H][H].[H][H] |
| InChI | InChI=1S/C26H38N4O3.2H2/c1-26(2,3)21-9-11-23(12-10-21)30(19-33-18-22-8-6-14-28-22)24(20-7-5-13-27-17-20)25(31)29-15-16-32-4;;/h5,7,9-13,17,22,24,28H,6,8,14-16,18-19H2,1-4H3,(H,29,31);2*1H |
| InChIKey | VJFYUIHQESBUSP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|