C27H33N5O3 — CID 156894097
N-(4-tert-butylphenyl)-1-cyano-N-(2-morpholin-4-yl-2-oxo-1-pyridin-3-ylethyl)pyrrolidine-2-carboxamide (PubChem CID 156894097) has the molecular formula C27H33N5O3 and a molecular weight of 475.59 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-1-cyano-N-(2-morpholin-4-yl-2-oxo-1-pyridin-3-ylethyl)pyrrolidine-2-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-1-cyano-N-(2-morpholin-4-yl-2-oxo-1-pyridin-3-ylethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 156894097 |
| Molecular Formula | C27H33N5O3 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | N-(4-tert-butylphenyl)-1-cyano-N-(2-morpholin-4-yl-2-oxo-1-pyridin-3-ylethyl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(N(C(=O)C2CCCN2C#N)C(C(=O)N2CCOCC2)c2cccnc2)cc1 |
| InChI | InChI=1S/C27H33N5O3/c1-27(2,3)21-8-10-22(11-9-21)32(25(33)23-7-5-13-31(23)19-28)24(20-6-4-12-29-18-20)26(34)30-14-16-35-17-15-30/h4,6,8-12,18,23-24H,5,7,13-17H2,1-3H3 |
| InChIKey | QZDCICMZMONBEW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 89.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|