C29H32N6O2 — CID 156894217
(2R)-N-(4-tert-butylphenyl)-1-cyano-N-[2-oxo-1-pyridin-3-yl-2-(pyridin-4-ylmethylamino)ethyl]pyrrolidine-2-carboxamide (PubChem CID 156894217) has the molecular formula C29H32N6O2 and a molecular weight of 496.62 g/mol. Its IUPAC name is (2R)-N-(4-tert-butylphenyl)-1-cyano-N-[2-oxo-1-pyridin-3-yl-2-(pyridin-4-ylmethylamino)ethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-(4-tert-butylphenyl)-1-cyano-N-[2-oxo-1-pyridin-3-yl-2-(pyridin-4-ylmethylamino)ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 156894217 |
| Molecular Formula | C29H32N6O2 |
| Molecular Weight | 496.62 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | (2R)-N-(4-tert-butylphenyl)-1-cyano-N-[2-oxo-1-pyridin-3-yl-2-(pyridin-4-ylmethylamino)ethyl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(N(C(=O)[C@H]2CCCN2C#N)C(C(=O)NCc2ccncc2)c2cccnc2)cc1 |
| InChI | InChI=1S/C29H32N6O2/c1-29(2,3)23-8-10-24(11-9-23)35(28(37)25-7-5-17-34(25)20-30)26(22-6-4-14-32-19-22)27(36)33-18-21-12-15-31-16-13-21/h4,6,8-16,19,25-26H,5,7,17-18H2,1-3H3,(H,33,36)/t25-,26?/m1/s1 |
| InChIKey | XVQBWTPACGACBB-DCWQJPKNSA-N |
| XLogP | 4.11 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.62 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|