C27H36N2O5 — CID 102361152
N-tert-butyl-5,6-dihydroxy-2-[(4-methoxyphenyl)methyl-[(E)-3-phenylprop-2-enoyl]amino]hexanamide (PubChem CID 102361152) has the molecular formula C27H36N2O5 and a molecular weight of 468.59 g/mol. Its IUPAC name is N-tert-butyl-5,6-dihydroxy-2-[(4-methoxyphenyl)methyl-[(E)-3-phenylprop-2-enoyl]amino]hexanamide.
| Compound Name | N-tert-butyl-5,6-dihydroxy-2-[(4-methoxyphenyl)methyl-[(E)-3-phenylprop-2-enoyl]amino]hexanamide |
|---|---|
| PubChem CID | 102361152 |
| Molecular Formula | C27H36N2O5 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | N-tert-butyl-5,6-dihydroxy-2-[(4-methoxyphenyl)methyl-[(E)-3-phenylprop-2-enoyl]amino]hexanamide |
| SMILES | COc1ccc(CN(C(=O)/C=C/c2ccccc2)C(CCC(O)CO)C(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C27H36N2O5/c1-27(2,3)28-26(33)24(16-13-22(31)19-30)29(18-21-10-14-23(34-4)15-11-21)25(32)17-12-20-8-6-5-7-9-20/h5-12,14-15,17,22,24,30-31H,13,16,18-19H2,1-4H3,(H,28,33)/b17-12+ |
| InChIKey | JADFBNNOTGNJIB-SFQUDFHCSA-N |
| XLogP | 3.15 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|