C37H42N2O5 — CID 177484124
(E)-N-benzyl-3-[3,4-bis(prop-2-enoxy)phenyl]-N-[(1S)-2-(tert-butylamino)-2-oxo-1-(4-prop-2-enoxyphenyl)ethyl]prop-2-enamide (PubChem CID 177484124) has the molecular formula C37H42N2O5 and a molecular weight of 594.75 g/mol. Its IUPAC name is (E)-N-benzyl-3-[3,4-bis(prop-2-enoxy)phenyl]-N-[(1S)-2-(tert-butylamino)-2-oxo-1-(4-prop-2-enoxyphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-N-benzyl-3-[3,4-bis(prop-2-enoxy)phenyl]-N-[(1S)-2-(tert-butylamino)-2-oxo-1-(4-prop-2-enoxyphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 177484124 |
| Molecular Formula | C37H42N2O5 |
| Molecular Weight | 594.75 g/mol |
| Exact Mass | 594.31 |
| IUPAC Name | (E)-N-benzyl-3-[3,4-bis(prop-2-enoxy)phenyl]-N-[(1S)-2-(tert-butylamino)-2-oxo-1-(4-prop-2-enoxyphenyl)ethyl]prop-2-enamide |
| SMILES | C=CCOc1ccc([C@@H](C(=O)NC(C)(C)C)N(Cc2ccccc2)C(=O)/C=C/c2ccc(OCC=C)c(OCC=C)c2)cc1 |
| InChI | InChI=1S/C37H42N2O5/c1-7-23-42-31-19-17-30(18-20-31)35(36(41)38-37(4,5)6)39(27-29-13-11-10-12-14-29)34(40)22-16-28-15-21-32(43-24-8-2)33(26-28)44-25-9-3/h7-22,26,35H,1-3,23-25,27H2,4-6H3,(H,38,41)/b22-16+/t35-/m0/s1 |
| InChIKey | HNXGGWHQFRNSIL-FOZBOTJLSA-N |
| XLogP | 7.08 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.75 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|