C23H25N3O3 — CID 40898420
(2R)-N-(5-methyl-1,2-oxazol-3-yl)-2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]-2-phenylacetamide (PubChem CID 40898420) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is (2R)-N-(5-methyl-1,2-oxazol-3-yl)-2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]-2-phenylacetamide.
| Compound Name | (2R)-N-(5-methyl-1,2-oxazol-3-yl)-2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 40898420 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | (2R)-N-(5-methyl-1,2-oxazol-3-yl)-2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]-2-phenylacetamide |
| SMILES | C=CCOc1ccc(CN(C)[C@@H](C(=O)Nc2cc(C)on2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H25N3O3/c1-4-14-28-20-12-10-18(11-13-20)16-26(3)22(19-8-6-5-7-9-19)23(27)24-21-15-17(2)29-25-21/h4-13,15,22H,1,14,16H2,2-3H3,(H,24,25,27)/t22-/m1/s1 |
| InChIKey | IYCCDZZPIKAZME-JOCHJYFZSA-N |
| XLogP | 4.36 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|