C21H18F3N5O5 — CID 122437562
2-[[4-[hydroxy(methyl)carbamoyl]phenyl]methyl]-4-[[4-(trifluoromethyl)phenyl]carbamoylamino]-1H-imidazole-5-carboxylic acid (PubChem CID 122437562) has the molecular formula C21H18F3N5O5 and a molecular weight of 477.40 g/mol. Its IUPAC name is 2-[[4-[hydroxy(methyl)carbamoyl]phenyl]methyl]-4-[[4-(trifluoromethyl)phenyl]carbamoylamino]-1H-imidazole-5-carboxylic acid.
| Compound Name | 2-[[4-[hydroxy(methyl)carbamoyl]phenyl]methyl]-4-[[4-(trifluoromethyl)phenyl]carbamoylamino]-1H-imidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 122437562 |
| Molecular Formula | C21H18F3N5O5 |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 2-[[4-[hydroxy(methyl)carbamoyl]phenyl]methyl]-4-[[4-(trifluoromethyl)phenyl]carbamoylamino]-1H-imidazole-5-carboxylic acid |
| SMILES | CN(O)C(=O)c1ccc(Cc2nc(NC(=O)Nc3ccc(C(F)(F)F)cc3)c(C(=O)O)[nH]2)cc1 |
| InChI | InChI=1S/C21H18F3N5O5/c1-29(34)18(30)12-4-2-11(3-5-12)10-15-26-16(19(31)32)17(27-15)28-20(33)25-14-8-6-13(7-9-14)21(22,23)24/h2-9,34H,10H2,1H3,(H,26,27)(H,31,32)(H2,25,28,33) |
| InChIKey | RHHPQSFVJLVFBM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 147.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|