C20H23N3O4 — CID 122437946
N-hydroxy-2-oxo-4-[(4-propan-2-yloxyphenyl)methyl]-3,5-dihydro-1H-1,4-benzodiazepine-7-carboxamide (PubChem CID 122437946) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is N-hydroxy-2-oxo-4-[(4-propan-2-yloxyphenyl)methyl]-3,5-dihydro-1H-1,4-benzodiazepine-7-carboxamide.
| Compound Name | N-hydroxy-2-oxo-4-[(4-propan-2-yloxyphenyl)methyl]-3,5-dihydro-1H-1,4-benzodiazepine-7-carboxamide |
|---|---|
| PubChem CID | 122437946 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | N-hydroxy-2-oxo-4-[(4-propan-2-yloxyphenyl)methyl]-3,5-dihydro-1H-1,4-benzodiazepine-7-carboxamide |
| SMILES | CC(C)Oc1ccc(CN2CC(=O)Nc3ccc(C(=O)NO)cc3C2)cc1 |
| InChI | InChI=1S/C20H23N3O4/c1-13(2)27-17-6-3-14(4-7-17)10-23-11-16-9-15(20(25)22-26)5-8-18(16)21-19(24)12-23/h3-9,13,26H,10-12H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | HHOSWJMLSBBVPK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|