C21H25N3O5 — CID 122438161
(3R)-8-N-hydroxy-4-N-(4-methoxyphenyl)-3-propan-2-yl-3,5-dihydro-2H-1,4-benzoxazepine-4,8-dicarboxamide (PubChem CID 122438161) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is (3R)-8-N-hydroxy-4-N-(4-methoxyphenyl)-3-propan-2-yl-3,5-dihydro-2H-1,4-benzoxazepine-4,8-dicarboxamide.
| Compound Name | (3R)-8-N-hydroxy-4-N-(4-methoxyphenyl)-3-propan-2-yl-3,5-dihydro-2H-1,4-benzoxazepine-4,8-dicarboxamide |
|---|---|
| PubChem CID | 122438161 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | (3R)-8-N-hydroxy-4-N-(4-methoxyphenyl)-3-propan-2-yl-3,5-dihydro-2H-1,4-benzoxazepine-4,8-dicarboxamide |
| SMILES | COc1ccc(NC(=O)N2Cc3ccc(C(=O)NO)cc3OC[C@H]2C(C)C)cc1 |
| InChI | InChI=1S/C21H25N3O5/c1-13(2)18-12-29-19-10-14(20(25)23-27)4-5-15(19)11-24(18)21(26)22-16-6-8-17(28-3)9-7-16/h4-10,13,18,27H,11-12H2,1-3H3,(H,22,26)(H,23,25)/t18-/m0/s1 |
| InChIKey | SQJLJNBMYZYVIR-SFHVURJKSA-N |
| XLogP | 3.27 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|