C19H23N3O4S — CID 161487776
(3S)-8-N-hydroxy-3-methyl-4-N-(4-methylphenyl)-3,5-dihydro-2H-1,4-benzoxazepine-4,8-dicarboxamide;sulfane (PubChem CID 161487776) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is (3S)-8-N-hydroxy-3-methyl-4-N-(4-methylphenyl)-3,5-dihydro-2H-1,4-benzoxazepine-4,8-dicarboxamide;sulfane.
| Compound Name | (3S)-8-N-hydroxy-3-methyl-4-N-(4-methylphenyl)-3,5-dihydro-2H-1,4-benzoxazepine-4,8-dicarboxamide;sulfane |
|---|---|
| PubChem CID | 161487776 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | (3S)-8-N-hydroxy-3-methyl-4-N-(4-methylphenyl)-3,5-dihydro-2H-1,4-benzoxazepine-4,8-dicarboxamide;sulfane |
| SMILES | Cc1ccc(NC(=O)N2Cc3ccc(C(=O)NO)cc3OC[C@@H]2C)cc1.S |
| InChI | InChI=1S/C19H21N3O4.H2S/c1-12-3-7-16(8-4-12)20-19(24)22-10-15-6-5-14(18(23)21-25)9-17(15)26-11-13(22)2;/h3-9,13,25H,10-11H2,1-2H3,(H,20,24)(H,21,23);1H2/t13-;/m0./s1 |
| InChIKey | WFEUUOLLEQDUES-ZOWNYOTGSA-N |
| XLogP | 3.04 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|