C23H25N3O5 — CID 122440228
N-hydroxy-4-(spiro[2H-1-benzofuran-3,4'-piperidine]-2-carbonyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide (PubChem CID 122440228) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is N-hydroxy-4-(spiro[2H-1-benzofuran-3,4'-piperidine]-2-carbonyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide.
| Compound Name | N-hydroxy-4-(spiro[2H-1-benzofuran-3,4'-piperidine]-2-carbonyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide |
|---|---|
| PubChem CID | 122440228 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N-hydroxy-4-(spiro[2H-1-benzofuran-3,4'-piperidine]-2-carbonyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide |
| SMILES | O=C(NO)c1ccc2c(c1)OCCN(C(=O)C1Oc3ccccc3C13CCNCC3)C2 |
| InChI | InChI=1S/C23H25N3O5/c27-21(25-29)15-5-6-16-14-26(11-12-30-19(16)13-15)22(28)20-23(7-9-24-10-8-23)17-3-1-2-4-18(17)31-20/h1-6,13,20,24,29H,7-12,14H2,(H,25,27) |
| InChIKey | ZEGWEJMMFYKBRK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|