C21H31N3O3 — CID 138605596
4-(3-azaspiro[5.5]undecan-9-ylmethyl)-N-hydroxy-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide (PubChem CID 138605596) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is 4-(3-azaspiro[5.5]undecan-9-ylmethyl)-N-hydroxy-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide.
| Compound Name | 4-(3-azaspiro[5.5]undecan-9-ylmethyl)-N-hydroxy-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide |
|---|---|
| PubChem CID | 138605596 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 4-(3-azaspiro[5.5]undecan-9-ylmethyl)-N-hydroxy-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide |
| SMILES | O=C(NO)c1ccc2c(c1)OCCN(CC1CCC3(CCNCC3)CC1)C2 |
| InChI | InChI=1S/C21H31N3O3/c25-20(23-26)17-1-2-18-15-24(11-12-27-19(18)13-17)14-16-3-5-21(6-4-16)7-9-22-10-8-21/h1-2,13,16,22,26H,3-12,14-15H2,(H,23,25) |
| InChIKey | CZTTUTUEYIURLN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|