C18H16ClFN4O — CID 122441037
3-(3-chlorophenyl)-N-[1-[(4-fluorophenyl)methyl]triazol-4-yl]propanamide (PubChem CID 122441037) has the molecular formula C18H16ClFN4O and a molecular weight of 358.80 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-[1-[(4-fluorophenyl)methyl]triazol-4-yl]propanamide.
| Compound Name | 3-(3-chlorophenyl)-N-[1-[(4-fluorophenyl)methyl]triazol-4-yl]propanamide |
|---|---|
| PubChem CID | 122441037 |
| Molecular Formula | C18H16ClFN4O |
| Molecular Weight | 358.80 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 3-(3-chlorophenyl)-N-[1-[(4-fluorophenyl)methyl]triazol-4-yl]propanamide |
| SMILES | O=C(CCc1cccc(Cl)c1)Nc1cn(Cc2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C18H16ClFN4O/c19-15-3-1-2-13(10-15)6-9-18(25)21-17-12-24(23-22-17)11-14-4-7-16(20)8-5-14/h1-5,7-8,10,12H,6,9,11H2,(H,21,25) |
| InChIKey | VCJIVTZFFNFAPR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.80 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |