C20H18FNO — CID 122441896
1-(7-fluoro-2-phenylquinolin-3-yl)pent-4-en-1-ol (PubChem CID 122441896) has the molecular formula C20H18FNO and a molecular weight of 307.37 g/mol. Its IUPAC name is 1-(7-fluoro-2-phenylquinolin-3-yl)pent-4-en-1-ol.
| Compound Name | 1-(7-fluoro-2-phenylquinolin-3-yl)pent-4-en-1-ol |
|---|---|
| PubChem CID | 122441896 |
| Molecular Formula | C20H18FNO |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 1-(7-fluoro-2-phenylquinolin-3-yl)pent-4-en-1-ol |
| SMILES | C=CCCC(O)c1cc2ccc(F)cc2nc1-c1ccccc1 |
| InChI | InChI=1S/C20H18FNO/c1-2-3-9-19(23)17-12-15-10-11-16(21)13-18(15)22-20(17)14-7-5-4-6-8-14/h2,4-8,10-13,19,23H,1,3,9H2 |
| InChIKey | UYXGPVWLARABHK-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|