C19H40O2 — CID 122444816
3,7-diethyl-5,5-bis(methoxymethyl)undecane (PubChem CID 122444816) has the molecular formula C19H40O2 and a molecular weight of 300.53 g/mol. Its IUPAC name is 3,7-diethyl-5,5-bis(methoxymethyl)undecane.
| Compound Name | 3,7-diethyl-5,5-bis(methoxymethyl)undecane |
|---|---|
| PubChem CID | 122444816 |
| Molecular Formula | C19H40O2 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.30 |
| IUPAC Name | 3,7-diethyl-5,5-bis(methoxymethyl)undecane |
| SMILES | CCCCC(CC)CC(COC)(COC)CC(CC)CC |
| InChI | InChI=1S/C19H40O2/c1-7-11-12-18(10-4)14-19(15-20-5,16-21-6)13-17(8-2)9-3/h17-18H,7-16H2,1-6H3 |
| InChIKey | AWPOYCTWUWDIHA-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |