C30H25N5O6S — CID 122447013
3-aminobenzoic acid;3-[[3-(5,6-dimethoxy-1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-yl]amino]benzoic acid (PubChem CID 122447013) has the molecular formula C30H25N5O6S and a molecular weight of 583.63 g/mol. Its IUPAC name is 3-aminobenzoic acid;3-[[3-(5,6-dimethoxy-1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-yl]amino]benzoic acid.
| Compound Name | 3-aminobenzoic acid;3-[[3-(5,6-dimethoxy-1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 122447013 |
| Molecular Formula | C30H25N5O6S |
| Molecular Weight | 583.63 g/mol |
| Exact Mass | 583.15 |
| IUPAC Name | 3-aminobenzoic acid;3-[[3-(5,6-dimethoxy-1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-yl]amino]benzoic acid |
| SMILES | COc1cc2cc(-c3cnc4ccc(Nc5cccc(C(=O)O)c5)nn34)sc2cc1OC.Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C23H18N4O4S.C7H7NO2/c1-30-17-9-14-10-20(32-19(14)11-18(17)31-2)16-12-24-22-7-6-21(26-27(16)22)25-15-5-3-4-13(8-15)23(28)29;8-6-3-1-2-5(4-6)7(9)10/h3-12H,1-2H3,(H,25,26)(H,28,29);1-4H,8H2,(H,9,10) |
| InChIKey | PPDZZZDYABXDNH-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 161.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.63 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|