C26H33N3O3 — CID 122447227
amino 3-[4-[5-(4-heptoxyphenyl)-1H-imidazol-2-yl]phenyl]-2-methylpropanoate (PubChem CID 122447227) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is amino 3-[4-[5-(4-heptoxyphenyl)-1H-imidazol-2-yl]phenyl]-2-methylpropanoate.
| Compound Name | amino 3-[4-[5-(4-heptoxyphenyl)-1H-imidazol-2-yl]phenyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 122447227 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | amino 3-[4-[5-(4-heptoxyphenyl)-1H-imidazol-2-yl]phenyl]-2-methylpropanoate |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(C)C(=O)ON)cc3)[nH]2)cc1 |
| InChI | InChI=1S/C26H33N3O3/c1-3-4-5-6-7-16-31-23-14-12-21(13-15-23)24-18-28-25(29-24)22-10-8-20(9-11-22)17-19(2)26(30)32-27/h8-15,18-19H,3-7,16-17,27H2,1-2H3,(H,28,29) |
| InChIKey | GOAQYCRBCMSOGR-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|