C20H13FN4O2 — CID 122447487
2-(1H-benzimidazol-2-yl)-6-(6-fluoro-5-methoxy-3-pyridinyl)-1,3-benzoxazole (PubChem CID 122447487) has the molecular formula C20H13FN4O2 and a molecular weight of 360.35 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-6-(6-fluoro-5-methoxy-3-pyridinyl)-1,3-benzoxazole.
| Compound Name | 2-(1H-benzimidazol-2-yl)-6-(6-fluoro-5-methoxy-3-pyridinyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 122447487 |
| Molecular Formula | C20H13FN4O2 |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-6-(6-fluoro-5-methoxy-3-pyridinyl)-1,3-benzoxazole |
| SMILES | COc1cc(-c2ccc3nc(-c4nc5ccccc5[nH]4)oc3c2)cnc1F |
| InChI | InChI=1S/C20H13FN4O2/c1-26-17-9-12(10-22-18(17)21)11-6-7-15-16(8-11)27-20(25-15)19-23-13-4-2-3-5-14(13)24-19/h2-10H,1H3,(H,23,24) |
| InChIKey | RDPSRWDFEHLMLL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|