C19H27N3O4 — CID 122447696
(3S,4R)-3-[(1R)-1-hydroxyethyl]-4-[1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-oxopropan-2-yl]azetidin-2-one (PubChem CID 122447696) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is (3S,4R)-3-[(1R)-1-hydroxyethyl]-4-[1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-oxopropan-2-yl]azetidin-2-one.
| Compound Name | (3S,4R)-3-[(1R)-1-hydroxyethyl]-4-[1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-oxopropan-2-yl]azetidin-2-one |
|---|---|
| PubChem CID | 122447696 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (3S,4R)-3-[(1R)-1-hydroxyethyl]-4-[1-[4-(4-methoxyphenyl)piperazin-1-yl]-1-oxopropan-2-yl]azetidin-2-one |
| SMILES | COc1ccc(N2CCN(C(=O)C(C)[C@H]3NC(=O)[C@@H]3[C@@H](C)O)CC2)cc1 |
| InChI | InChI=1S/C19H27N3O4/c1-12(17-16(13(2)23)18(24)20-17)19(25)22-10-8-21(9-11-22)14-4-6-15(26-3)7-5-14/h4-7,12-13,16-17,23H,8-11H2,1-3H3,(H,20,24)/t12?,13-,16-,17-/m1/s1 |
| InChIKey | KWAWLAIEISUBKW-BQZPIORYSA-N |
| XLogP | 0.48 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|