C20H20N2O2 — CID 122447898
4-hydroxy-1-methyl-3-[1-[(3-phenylphenyl)methylamino]ethenyl]-2H-pyrrol-5-one (PubChem CID 122447898) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 4-hydroxy-1-methyl-3-[1-[(3-phenylphenyl)methylamino]ethenyl]-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-1-methyl-3-[1-[(3-phenylphenyl)methylamino]ethenyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 122447898 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 4-hydroxy-1-methyl-3-[1-[(3-phenylphenyl)methylamino]ethenyl]-2H-pyrrol-5-one |
| SMILES | C=C(NCc1cccc(-c2ccccc2)c1)C1=C(O)C(=O)N(C)C1 |
| InChI | InChI=1S/C20H20N2O2/c1-14(18-13-22(2)20(24)19(18)23)21-12-15-7-6-10-17(11-15)16-8-4-3-5-9-16/h3-11,21,23H,1,12-13H2,2H3 |
| InChIKey | DATIUYMUEAONHU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |