C21H23N3O5S — CID 123553021
N-[[3-[4-(methanesulfonamidomethyl)phenyl]phenyl]methyl]-1-methyl-4,5-dioxopyrrolidine-3-carboxamide (PubChem CID 123553021) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is N-[[3-[4-(methanesulfonamidomethyl)phenyl]phenyl]methyl]-1-methyl-4,5-dioxopyrrolidine-3-carboxamide.
| Compound Name | N-[[3-[4-(methanesulfonamidomethyl)phenyl]phenyl]methyl]-1-methyl-4,5-dioxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 123553021 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | N-[[3-[4-(methanesulfonamidomethyl)phenyl]phenyl]methyl]-1-methyl-4,5-dioxopyrrolidine-3-carboxamide |
| SMILES | CN1CC(C(=O)NCc2cccc(-c3ccc(CNS(C)(=O)=O)cc3)c2)C(=O)C1=O |
| InChI | InChI=1S/C21H23N3O5S/c1-24-13-18(19(25)21(24)27)20(26)22-11-15-4-3-5-17(10-15)16-8-6-14(7-9-16)12-23-30(2,28)29/h3-10,18,23H,11-13H2,1-2H3,(H,22,26) |
| InChIKey | PUCLWSIDXNQAPX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|