C10H12IN3 — CID 122448322
5-iodo-1,2-dimethylpentane-1,2,5-tricarbonitrile (PubChem CID 122448322) has the molecular formula C10H12IN3 and a molecular weight of 301.13 g/mol. Its IUPAC name is 5-iodo-1,2-dimethylpentane-1,2,5-tricarbonitrile.
| Compound Name | 5-iodo-1,2-dimethylpentane-1,2,5-tricarbonitrile |
|---|---|
| PubChem CID | 122448322 |
| Molecular Formula | C10H12IN3 |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 5-iodo-1,2-dimethylpentane-1,2,5-tricarbonitrile |
| SMILES | CC(C#N)C(C)(C#N)CCC(I)C#N |
| InChI | InChI=1S/C10H12IN3/c1-8(5-12)10(2,7-14)4-3-9(11)6-13/h8-9H,3-4H2,1-2H3 |
| InChIKey | YOJGLJZWEPPQAV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|