C27H44O4 — CID 122449132
(2R,6R)-6-[(3S,7S,8S,9S,10R,13R,14S,17R)-3-deuterio-3,7-dihydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-methylheptanoic acid (PubChem CID 122449132) has the molecular formula C27H44O4 and a molecular weight of 433.65 g/mol. Its IUPAC name is (2R,6R)-6-[(3S,7S,8S,9S,10R,13R,14S,17R)-3-deuterio-3,7-dihydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-methylheptanoic acid.
| Compound Name | (2R,6R)-6-[(3S,7S,8S,9S,10R,13R,14S,17R)-3-deuterio-3,7-dihydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-methylheptanoic acid |
|---|---|
| PubChem CID | 122449132 |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 433.65 g/mol |
| Exact Mass | 433.33 |
| IUPAC Name | (2R,6R)-6-[(3S,7S,8S,9S,10R,13R,14S,17R)-3-deuterio-3,7-dihydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-methylheptanoic acid |
| SMILES | [2H][C@]1(O)CC[C@@]2(C)C(=C[C@@H](O)[C@H]3[C@@H]4CC[C@H]([C@H](C)CCC[C@@H](C)C(=O)O)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C27H44O4/c1-16(6-5-7-17(2)25(30)31)20-8-9-21-24-22(11-13-27(20,21)4)26(3)12-10-19(28)14-18(26)15-23(24)29/h15-17,19-24,28-29H,5-14H2,1-4H3,(H,30,31)/t16-,17-,19+,20-,21+,22+,23-,24+,26+,27-/m1/s1/i19D |
| InChIKey | GYJSAWZGYQXRBS-JUMNXPSUSA-N |
| XLogP | 5.42 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.65 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|