About 2-chloropentane
2-chloropentane (PubChem CID 12245) has the molecular formula C5H11Cl
and a molecular weight of 106.60 g/mol. Its IUPAC name is 2-chloropentane.
Molecular Properties
| Compound Name | 2-chloropentane |
| PubChem CID | 12245 |
| Molecular Formula | C5H11Cl |
| Molecular Weight | 106.60 g/mol |
| Exact Mass | 106.05 |
| IUPAC Name | 2-chloropentane |
| SMILES | CCCC(C)Cl |
| InChI | InChI=1S/C5H11Cl/c1-3-4-5(2)6/h5H,3-4H2,1-2H3 |
| InChIKey | NFRKUDYZEVQXTE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.60 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloropentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloropentane?
The IUPAC name of 2-chloropentane (CID 12245) is 2-chloropentane.
What is the SMILES notation for 2-chloropentane?
The canonical SMILES for 2-chloropentane is CCCC(C)Cl.
What is the InChIKey of 2-chloropentane?
The InChIKey is NFRKUDYZEVQXTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11Cl/c1-3-4-5(2)6/h5H,3-4H2,1-2H3.
What are the key properties of 2-chloropentane?
2-chloropentane has a molecular weight of 106.60 g/mol, XLogP of 2.41, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloropentane is sourced from PubChem (CID 12245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).