About 2,5-dichlorohexane
2,5-dichlorohexane (PubChem CID 25823) has the molecular formula C6H12Cl2
and a molecular weight of 155.07 g/mol. Its IUPAC name is 2,5-dichlorohexane.
Molecular Properties
| Compound Name | 2,5-dichlorohexane |
| PubChem CID | 25823 |
| Molecular Formula | C6H12Cl2 |
| Molecular Weight | 155.07 g/mol |
| Exact Mass | 154.03 |
| IUPAC Name | 2,5-dichlorohexane |
| SMILES | CC(Cl)CCC(C)Cl |
| InChI | InChI=1S/C6H12Cl2/c1-5(7)3-4-6(2)8/h5-6H,3-4H2,1-2H3 |
| InChIKey | RRFNCPBJVPQIPP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.07 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dichlorohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dichlorohexane?
The IUPAC name of 2,5-dichlorohexane (CID 25823) is 2,5-dichlorohexane.
What is the SMILES notation for 2,5-dichlorohexane?
The canonical SMILES for 2,5-dichlorohexane is CC(Cl)CCC(C)Cl.
What is the InChIKey of 2,5-dichlorohexane?
The InChIKey is RRFNCPBJVPQIPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12Cl2/c1-5(7)3-4-6(2)8/h5-6H,3-4H2,1-2H3.
What are the key properties of 2,5-dichlorohexane?
2,5-dichlorohexane has a molecular weight of 155.07 g/mol, XLogP of 3.02, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichlorohexane is sourced from PubChem (CID 25823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).